C11H20F5NO3S — CID 86696816
3-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-1-ol (PubChem CID 86696816) has the molecular formula C11H20F5NO3S and a molecular weight of 341.34 g/mol. Its IUPAC name is 3-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-1-ol.
| Compound Name | 3-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-1-ol |
|---|---|
| PubChem CID | 86696816 |
| Molecular Formula | C11H20F5NO3S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-1-ol |
| SMILES | O=S(=O)(CCCNCCCO)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5NO3S/c12-10(13,11(14,15)16)4-1-8-21(19,20)9-3-6-17-5-2-7-18/h17-18H,1-9H2 |
| InChIKey | CYCLMZJOIJPSMR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|