C10H19NO2S2 — CID 80599834
1,1-dioxo-N-(thian-2-ylmethyl)thiolan-3-amine (PubChem CID 80599834) has the molecular formula C10H19NO2S2 and a molecular weight of 249.40 g/mol. Its IUPAC name is 1,1-dioxo-N-(thian-2-ylmethyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(thian-2-ylmethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 80599834 |
| Molecular Formula | C10H19NO2S2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1,1-dioxo-N-(thian-2-ylmethyl)thiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCC2CCCCS2)C1 |
| InChI | InChI=1S/C10H19NO2S2/c12-15(13)6-4-9(8-15)11-7-10-3-1-2-5-14-10/h9-11H,1-8H2 |
| InChIKey | VKNQFXLMCWEFSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |