C14H27NO2 — CID 65084789
ethyl 4-methyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate (PubChem CID 65084789) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is ethyl 4-methyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate.
| Compound Name | ethyl 4-methyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 65084789 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | ethyl 4-methyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(C)C)CCCC(C)CC1 |
| InChI | InChI=1S/C14H27NO2/c1-5-17-13(16)14(15-11(2)3)9-6-7-12(4)8-10-14/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | WMGXTGWKIRGWTH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |