C17H33NO2 — CID 65094919
ethyl 4-tert-butyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate (PubChem CID 65094919) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is ethyl 4-tert-butyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate.
| Compound Name | ethyl 4-tert-butyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 65094919 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | ethyl 4-tert-butyl-1-(propan-2-ylamino)cycloheptane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(C)C)CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33NO2/c1-7-20-15(19)17(18-13(2)3)11-8-9-14(10-12-17)16(4,5)6/h13-14,18H,7-12H2,1-6H3 |
| InChIKey | NKRUJJMMVQPFBQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |