C16H29NO2 — CID 55063384
ethyl 4-tert-butyl-1-(prop-2-enylamino)cyclohexane-1-carboxylate (PubChem CID 55063384) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is ethyl 4-tert-butyl-1-(prop-2-enylamino)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-tert-butyl-1-(prop-2-enylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55063384 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | ethyl 4-tert-butyl-1-(prop-2-enylamino)cyclohexane-1-carboxylate |
| SMILES | C=CCNC1(C(=O)OCC)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO2/c1-6-12-17-16(14(18)19-7-2)10-8-13(9-11-16)15(3,4)5/h6,13,17H,1,7-12H2,2-5H3 |
| InChIKey | ZHLOQVVTSLVZLM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|