C27H31N7O — CID 650853
3-[(1-cyclopentyltetrazol-5-yl)-(4-phenylpiperazin-1-yl)methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 650853) has the molecular formula C27H31N7O and a molecular weight of 469.59 g/mol. Its IUPAC name is 3-[(1-cyclopentyltetrazol-5-yl)-(4-phenylpiperazin-1-yl)methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-phenylpiperazin-1-yl)methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 650853 |
| Molecular Formula | C27H31N7O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-phenylpiperazin-1-yl)methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(C(c3nnnn3C3CCCC3)N3CCN(c4ccccc4)CC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C27H31N7O/c1-19-11-12-20-18-23(27(35)28-24(20)17-19)25(26-29-30-31-34(26)22-9-5-6-10-22)33-15-13-32(14-16-33)21-7-3-2-4-8-21/h2-4,7-8,11-12,17-18,22,25H,5-6,9-10,13-16H2,1H3,(H,28,35) |
| InChIKey | ADHPEXKPDZDCGO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |