C18H31NO2 — CID 65090798
3-[(4-propylcycloheptyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 65090798) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 3-[(4-propylcycloheptyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[(4-propylcycloheptyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 65090798 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 3-[(4-propylcycloheptyl)amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCCC1CCCC(NC2C3CCC(C3)C2C(=O)O)CC1 |
| InChI | InChI=1S/C18H31NO2/c1-2-4-12-5-3-6-15(10-7-12)19-17-14-9-8-13(11-14)16(17)18(20)21/h12-17,19H,2-11H2,1H3,(H,20,21) |
| InChIKey | BUTZMAPETWLQGY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |