C13H27NO2S — CID 65093543
N-(3-ethylsulfonylpropyl)-3,5-dimethylcyclohexan-1-amine (PubChem CID 65093543) has the molecular formula C13H27NO2S and a molecular weight of 261.43 g/mol. Its IUPAC name is N-(3-ethylsulfonylpropyl)-3,5-dimethylcyclohexan-1-amine.
| Compound Name | N-(3-ethylsulfonylpropyl)-3,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 65093543 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-(3-ethylsulfonylpropyl)-3,5-dimethylcyclohexan-1-amine |
| SMILES | CCS(=O)(=O)CCCNC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C13H27NO2S/c1-4-17(15,16)7-5-6-14-13-9-11(2)8-12(3)10-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | XDJZSHIFSBMVGQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|