C11H23NO — CID 96732218
3-[[(3R,5S)-3,5-dimethylcyclohexyl]amino]propan-1-ol (PubChem CID 96732218) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 3-[[(3R,5S)-3,5-dimethylcyclohexyl]amino]propan-1-ol.
| Compound Name | 3-[[(3R,5S)-3,5-dimethylcyclohexyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 96732218 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 3-[[(3R,5S)-3,5-dimethylcyclohexyl]amino]propan-1-ol |
| SMILES | C[C@@H]1CC(NCCCO)C[C@H](C)C1 |
| InChI | InChI=1S/C11H23NO/c1-9-6-10(2)8-11(7-9)12-4-3-5-13/h9-13H,3-8H2,1-2H3/t9-,10+,11? |
| InChIKey | QMMYVTFYROPTHM-ZACCUICWSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|