C15H25NO3S — CID 65095474
1-[3-(3-ethylsulfonylpropoxy)phenyl]butan-2-amine (PubChem CID 65095474) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-[3-(3-ethylsulfonylpropoxy)phenyl]butan-2-amine.
| Compound Name | 1-[3-(3-ethylsulfonylpropoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 65095474 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-[3-(3-ethylsulfonylpropoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cccc(OCCCS(=O)(=O)CC)c1 |
| InChI | InChI=1S/C15H25NO3S/c1-3-14(16)11-13-7-5-8-15(12-13)19-9-6-10-20(17,18)4-2/h5,7-8,12,14H,3-4,6,9-11,16H2,1-2H3 |
| InChIKey | NLPLZEITWDEDJU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|