3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid

C15H23NO3 — CID 79621115

IUPAC3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid
SMILESCCC(N)Cc1cccc(OCC(C)(C)C(=O)O)c1
InChIInChI=1S/C15H23NO3/c1-4-12(16)8-11-6-5-7-13(9-11)19-10-15(2,3)14(17)18/h5-7,9,12H,4,8,10,16H2,1-3H3,(H,17,18)
InChIKeyUHHAIBDBNUNVTQ-UHFFFAOYSA-N
MW265.35 g/mol
LogP2.46
Rot. Bonds7

About 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid

3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid (PubChem CID 79621115) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid
PubChem CID79621115
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Name3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid
SMILESCCC(N)Cc1cccc(OCC(C)(C)C(=O)O)c1
InChIInChI=1S/C15H23NO3/c1-4-12(16)8-11-6-5-7-13(9-11)19-10-15(2,3)14(17)18/h5-7,9,12H,4,8,10,16H2,1-3H3,(H,17,18)
InChIKeyUHHAIBDBNUNVTQ-UHFFFAOYSA-N
XLogP2.46
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 52.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid (CID 79621115) is 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid is CCC(N)Cc1cccc(OCC(C)(C)C(=O)O)c1.
What is the InChIKey of 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid?
The InChIKey is UHHAIBDBNUNVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-4-12(16)8-11-6-5-7-13(9-11)19-10-15(2,3)14(17)18/h5-7,9,12H,4,8,10,16H2,1-3H3,(H,17,18).
What are the key properties of 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid?
3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid has a molecular weight of 265.35 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminobutyl)phenoxy]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79621115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).