C12H27NO2S — CID 65097558
5-ethylsulfonyl-2,2-dimethyl-N-propylpentan-1-amine (PubChem CID 65097558) has the molecular formula C12H27NO2S and a molecular weight of 249.42 g/mol. Its IUPAC name is 5-ethylsulfonyl-2,2-dimethyl-N-propylpentan-1-amine.
| Compound Name | 5-ethylsulfonyl-2,2-dimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 65097558 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 5-ethylsulfonyl-2,2-dimethyl-N-propylpentan-1-amine |
| SMILES | CCCNCC(C)(C)CCCS(=O)(=O)CC |
| InChI | InChI=1S/C12H27NO2S/c1-5-9-13-11-12(3,4)8-7-10-16(14,15)6-2/h13H,5-11H2,1-4H3 |
| InChIKey | UNVQISCJSCVZRX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|