C12H17BF3O3S- — CID 65098183
[4-(3-ethylsulfonylpropoxy)-3-methylphenyl]-trifluoroboranuide (PubChem CID 65098183) has the molecular formula C12H17BF3O3S- and a molecular weight of 309.14 g/mol. Its IUPAC name is [4-(3-ethylsulfonylpropoxy)-3-methylphenyl]-trifluoroboranuide.
| Compound Name | [4-(3-ethylsulfonylpropoxy)-3-methylphenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 65098183 |
| Molecular Formula | C12H17BF3O3S- |
| Molecular Weight | 309.14 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | [4-(3-ethylsulfonylpropoxy)-3-methylphenyl]-trifluoroboranuide |
| SMILES | CCS(=O)(=O)CCCOc1ccc([B-](F)(F)F)cc1C |
| InChI | InChI=1S/C12H17BF3O3S/c1-3-20(17,18)8-4-7-19-12-6-5-11(9-10(12)2)13(14,15)16/h5-6,9H,3-4,7-8H2,1-2H3/q-1 |
| InChIKey | MLBDMLTTWWSZFG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|