C13H19BF3KO2 — CID 106454189
potassium trifluoro-[3-methyl-4-[2-(2-methylpropoxy)ethoxy]phenyl]boranuide (PubChem CID 106454189) has the molecular formula C13H19BF3KO2 and a molecular weight of 314.20 g/mol. Its IUPAC name is potassium trifluoro-[3-methyl-4-[2-(2-methylpropoxy)ethoxy]phenyl]boranuide.
| Compound Name | potassium trifluoro-[3-methyl-4-[2-(2-methylpropoxy)ethoxy]phenyl]boranuide |
|---|---|
| PubChem CID | 106454189 |
| Molecular Formula | C13H19BF3KO2 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | potassium trifluoro-[3-methyl-4-[2-(2-methylpropoxy)ethoxy]phenyl]boranuide |
| SMILES | Cc1cc([B-](F)(F)F)ccc1OCCOCC(C)C.[K+] |
| InChI | InChI=1S/C13H19BF3O2.K/c1-10(2)9-18-6-7-19-13-5-4-12(8-11(13)3)14(15,16)17;/h4-5,8,10H,6-7,9H2,1-3H3;/q-1;+1 |
| InChIKey | QAZKGADECPVVNI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|