C12H11F3N2O — CID 65098632
N-(1-cyano-2-methylpropyl)-2,4,6-trifluorobenzamide (PubChem CID 65098632) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is N-(1-cyano-2-methylpropyl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(1-cyano-2-methylpropyl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 65098632 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(1-cyano-2-methylpropyl)-2,4,6-trifluorobenzamide |
| SMILES | CC(C)C(C#N)NC(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H11F3N2O/c1-6(2)10(5-16)17-12(18)11-8(14)3-7(13)4-9(11)15/h3-4,6,10H,1-2H3,(H,17,18) |
| InChIKey | SUVAAMAXFPEZET-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |