C14H22Cl2N2O — CID 6510001
2-[(Z)-1-(4-chlorophenyl)ethylideneamino]oxy-N,N-diethylethanamine;hydrochloride (PubChem CID 6510001) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-[(Z)-1-(4-chlorophenyl)ethylideneamino]oxy-N,N-diethylethanamine;hydrochloride.
| Compound Name | 2-[(Z)-1-(4-chlorophenyl)ethylideneamino]oxy-N,N-diethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 6510001 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-[(Z)-1-(4-chlorophenyl)ethylideneamino]oxy-N,N-diethylethanamine;hydrochloride |
| SMILES | CCN(CC)CCO/N=C(/C)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H21ClN2O.ClH/c1-4-17(5-2)10-11-18-16-12(3)13-6-8-14(15)9-7-13;/h6-9H,4-5,10-11H2,1-3H3;1H/b16-12-; |
| InChIKey | UGPLUORMBKEGNT-PXJKFVASSA-N |
| XLogP | 3.84 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|