C12H13F3N2O — CID 65100401
N-(2-amino-2-cyclopropylethyl)-2,4,6-trifluorobenzamide (PubChem CID 65100401) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is N-(2-amino-2-cyclopropylethyl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(2-amino-2-cyclopropylethyl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 65100401 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-(2-amino-2-cyclopropylethyl)-2,4,6-trifluorobenzamide |
| SMILES | NC(CNC(=O)c1c(F)cc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C12H13F3N2O/c13-7-3-8(14)11(9(15)4-7)12(18)17-5-10(16)6-1-2-6/h3-4,6,10H,1-2,5,16H2,(H,17,18) |
| InChIKey | WBJQDCRYNSJSEE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |