C12H11F3N2OS — CID 65098584
N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-2,4,6-trifluorobenzamide (PubChem CID 65098584) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 65098584 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-2,4,6-trifluorobenzamide |
| SMILES | NC(=S)C(NC(=O)c1c(F)cc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C12H11F3N2OS/c13-6-3-7(14)9(8(15)4-6)12(18)17-10(11(16)19)5-1-2-5/h3-5,10H,1-2H2,(H2,16,19)(H,17,18) |
| InChIKey | XREHFFRZDHYHTR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|