C8H15N3OS — CID 79154410
3-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-1,1-dimethylurea (PubChem CID 79154410) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-1,1-dimethylurea.
| Compound Name | 3-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154410 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(C(N)=S)C1CC1 |
| InChI | InChI=1S/C8H15N3OS/c1-11(2)8(12)10-6(7(9)13)5-3-4-5/h5-6H,3-4H2,1-2H3,(H2,9,13)(H,10,12) |
| InChIKey | XLQDPOVLLKQONO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|