C10H22N2O2 — CID 65107360
2-amino-N-(2-hydroxy-2-methylpropyl)-2-methylpentanamide (PubChem CID 65107360) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-2-methylpropyl)-2-methylpentanamide.
| Compound Name | 2-amino-N-(2-hydroxy-2-methylpropyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 65107360 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-amino-N-(2-hydroxy-2-methylpropyl)-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)NCC(C)(C)O |
| InChI | InChI=1S/C10H22N2O2/c1-5-6-10(4,11)8(13)12-7-9(2,3)14/h14H,5-7,11H2,1-4H3,(H,12,13) |
| InChIKey | SXYKQHOSIXKOAK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |