C12H28ClN3O3S — CID 119728954
2-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylpentanamide;hydrochloride (PubChem CID 119728954) has the molecular formula C12H28ClN3O3S and a molecular weight of 329.89 g/mol. Its IUPAC name is 2-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119728954 |
| Molecular Formula | C12H28ClN3O3S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-amino-N-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)NCCCN(C)S(=O)(=O)CC.Cl |
| InChI | InChI=1S/C12H27N3O3S.ClH/c1-5-8-12(3,13)11(16)14-9-7-10-15(4)19(17,18)6-2;/h5-10,13H2,1-4H3,(H,14,16);1H |
| InChIKey | FLXWNZKRWYLALD-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|