C12H26N2O2 — CID 65111812
2-[(2-hydroxy-2-methylbutyl)amino]-N-pentan-3-ylacetamide (PubChem CID 65111812) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-methylbutyl)amino]-N-pentan-3-ylacetamide.
| Compound Name | 2-[(2-hydroxy-2-methylbutyl)amino]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 65111812 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-[(2-hydroxy-2-methylbutyl)amino]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CNCC(C)(O)CC |
| InChI | InChI=1S/C12H26N2O2/c1-5-10(6-2)14-11(15)8-13-9-12(4,16)7-3/h10,13,16H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | KQKWETRAVLQYTH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |