C12H18INO3S — CID 65112960
N-(2-ethyl-2-hydroxybutyl)-4-iodobenzenesulfonamide (PubChem CID 65112960) has the molecular formula C12H18INO3S and a molecular weight of 383.25 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-4-iodobenzenesulfonamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 65112960 |
| Molecular Formula | C12H18INO3S |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-4-iodobenzenesulfonamide |
| SMILES | CCC(O)(CC)CNS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H18INO3S/c1-3-12(15,4-2)9-14-18(16,17)11-7-5-10(13)6-8-11/h5-8,14-15H,3-4,9H2,1-2H3 |
| InChIKey | OBPBZQBXFPGPHU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|