C10H18F3NO3 — CID 65114626
N-(2-hydroxy-2-methylbutyl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 65114626) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylbutyl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-hydroxy-2-methylbutyl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 65114626 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(2-hydroxy-2-methylbutyl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCC(C)(O)CNC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO3/c1-3-9(2,16)6-14-8(15)4-5-17-7-10(11,12)13/h16H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | FSFIOSGHGIULHK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|