C18H33NO — CID 65118073
1',1'-dimethyl-6-propylspiro[3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-2,4'-cyclohexane] (PubChem CID 65118073) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 1',1'-dimethyl-6-propylspiro[3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-2,4'-cyclohexane].
| Compound Name | 1',1'-dimethyl-6-propylspiro[3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-2,4'-cyclohexane] |
|---|---|
| PubChem CID | 65118073 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 1',1'-dimethyl-6-propylspiro[3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-2,4'-cyclohexane] |
| SMILES | CCCC1CCC2OC3(CCC(C)(C)CC3)CNC2C1 |
| InChI | InChI=1S/C18H33NO/c1-4-5-14-6-7-16-15(12-14)19-13-18(20-16)10-8-17(2,3)9-11-18/h14-16,19H,4-13H2,1-3H3 |
| InChIKey | KLVPKUGSNAUDRV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |