C13H23NO3S — CID 65120641
4'-ethylspiro[3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-2,1'-cyclohexane] 6,6-dioxide (PubChem CID 65120641) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 4'-ethylspiro[3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-2,1'-cyclohexane] 6,6-dioxide.
| Compound Name | 4'-ethylspiro[3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-2,1'-cyclohexane] 6,6-dioxide |
|---|---|
| PubChem CID | 65120641 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4'-ethylspiro[3,4,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine-2,1'-cyclohexane] 6,6-dioxide |
| SMILES | CCC1CCC2(CC1)CNC1CS(=O)(=O)CC1O2 |
| InChI | InChI=1S/C13H23NO3S/c1-2-10-3-5-13(6-4-10)9-14-11-7-18(15,16)8-12(11)17-13/h10-12,14H,2-9H2,1H3 |
| InChIKey | VAOYMASHGJPXDD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |