C14H16F5NO — CID 65118143
3-methyl-1-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol (PubChem CID 65118143) has the molecular formula C14H16F5NO and a molecular weight of 309.28 g/mol. Its IUPAC name is 3-methyl-1-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol.
| Compound Name | 3-methyl-1-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65118143 |
| Molecular Formula | C14H16F5NO |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-methyl-1-[(2,3,4,5,6-pentafluoroanilino)methyl]cyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNc2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C14H16F5NO/c1-7-3-2-4-14(21,5-7)6-20-13-11(18)9(16)8(15)10(17)12(13)19/h7,20-21H,2-6H2,1H3 |
| InChIKey | GFRMHXSXNSQZJA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|