C14H18BrClN2O2 — CID 65118505
5-bromo-2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]pyridine-3-carboxamide (PubChem CID 65118505) has the molecular formula C14H18BrClN2O2 and a molecular weight of 361.67 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 65118505 |
| Molecular Formula | C14H18BrClN2O2 |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 5-bromo-2-chloro-N-[(1-hydroxy-3-methylcyclohexyl)methyl]pyridine-3-carboxamide |
| SMILES | CC1CCCC(O)(CNC(=O)c2cc(Br)cnc2Cl)C1 |
| InChI | InChI=1S/C14H18BrClN2O2/c1-9-3-2-4-14(20,6-9)8-18-13(19)11-5-10(15)7-17-12(11)16/h5,7,9,20H,2-4,6,8H2,1H3,(H,18,19) |
| InChIKey | VYZRGEGFQIOTCL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|