C15H29NO2 — CID 65118984
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]hexanamide (PubChem CID 65118984) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]hexanamide.
| Compound Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]hexanamide |
|---|---|
| PubChem CID | 65118984 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]hexanamide |
| SMILES | CCCCCC(=O)NCC1(O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-4-5-6-7-13(17)16-12-15(18)10-8-14(2,3)9-11-15/h18H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | IKRRKYIJYDCUIK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|