C14H26N2O3S — CID 65119046
3-(2-amino-2-oxoethyl)sulfanyl-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]propanamide (PubChem CID 65119046) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 65119046 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]propanamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)CCSCC(N)=O)CC1 |
| InChI | InChI=1S/C14H26N2O3S/c1-13(2)4-6-14(19,7-5-13)10-16-12(18)3-8-20-9-11(15)17/h19H,3-10H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | DVQFLZRDGTWJLE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|