About N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 65119503) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide.
Molecular Properties
| Compound Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| PubChem CID | 65119503 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC1(C)CCC(O)(CNC(=O)C2CC3CCC2C3)CC1 |
| InChI | InChI=1S/C17H29NO2/c1-16(2)5-7-17(20,8-6-16)11-18-15(19)14-10-12-3-4-13(14)9-12/h12-14,20H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | ZDBIMXXYPAJFTB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide?
The IUPAC name of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide (CID 65119503) is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide.
What is the SMILES notation for N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide?
The canonical SMILES for N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide is CC1(C)CCC(O)(CNC(=O)C2CC3CCC2C3)CC1.
What is the InChIKey of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide?
The InChIKey is ZDBIMXXYPAJFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO2/c1-16(2)5-7-17(20,8-6-16)11-18-15(19)14-10-12-3-4-13(14)9-12/h12-14,20H,3-11H2,1-2H3,(H,18,19).
What are the key properties of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide?
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide has a molecular weight of 279.42 g/mol, XLogP of 2.87, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide is sourced from PubChem (CID 65119503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).