C26H42N2O2 — CID 98289118
(1R,2R,4R)-N-[[(1R,5S)-5-[[(1R,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]-1,3,3-trimethylcyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 98289118) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is (1R,2R,4R)-N-[[(1R,5S)-5-[[(1R,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]-1,3,3-trimethylcyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[[(1R,5S)-5-[[(1R,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]-1,3,3-trimethylcyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 98289118 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | (1R,2R,4R)-N-[[(1R,5S)-5-[[(1R,2R,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]-1,3,3-trimethylcyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC1(C)C[C@H](NC(=O)[C@@H]2C[C@@H]3CC[C@@H]2C3)C[C@](C)(CNC(=O)[C@@H]2C[C@@H]3CC[C@@H]2C3)C1 |
| InChI | InChI=1S/C26H42N2O2/c1-25(2)12-20(28-24(30)22-11-17-5-7-19(22)9-17)13-26(3,14-25)15-27-23(29)21-10-16-4-6-18(21)8-16/h16-22H,4-15H2,1-3H3,(H,27,29)(H,28,30)/t16-,17-,18-,19-,20+,21-,22-,26+/m1/s1 |
| InChIKey | BCUCJWQATQBQSA-RYAKVMGWSA-N |
| XLogP | 4.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |