C9H17NO2 — CID 65122091
2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane (PubChem CID 65122091) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane.
| Compound Name | 2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 65122091 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane |
| SMILES | CC1CNCC2(CCOCC2)O1 |
| InChI | InChI=1S/C9H17NO2/c1-8-6-10-7-9(12-8)2-4-11-5-3-9/h8,10H,2-7H2,1H3 |
| InChIKey | KFEHLGNNRIJKCV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |