C34H43NO5 — CID 6512473
(16E)-13-methyl-3-(2-pyrrolidin-1-ylethoxy)-16-[(3,4,5-trimethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one (PubChem CID 6512473) has the molecular formula C34H43NO5 and a molecular weight of 545.72 g/mol. Its IUPAC name is (16E)-13-methyl-3-(2-pyrrolidin-1-ylethoxy)-16-[(3,4,5-trimethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (16E)-13-methyl-3-(2-pyrrolidin-1-ylethoxy)-16-[(3,4,5-trimethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 6512473 |
| Molecular Formula | C34H43NO5 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | (16E)-13-methyl-3-(2-pyrrolidin-1-ylethoxy)-16-[(3,4,5-trimethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COc1cc(/C=C2\CC3C4CCc5cc(OCCN6CCCC6)ccc5C4CCC3(C)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C34H43NO5/c1-34-12-11-27-26-10-8-25(40-16-15-35-13-5-6-14-35)20-23(26)7-9-28(27)29(34)21-24(33(34)36)17-22-18-30(37-2)32(39-4)31(19-22)38-3/h8,10,17-20,27-29H,5-7,9,11-16,21H2,1-4H3/b24-17+ |
| InChIKey | JUBUTZARPJLCEI-JJIBRWJFSA-N |
| XLogP | 6.31 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|