C19H20N4O2S — CID 651272
2-(4-Phenethyl-5-phenoxymethyl-4H-[1,2,4]triazol-3-ylsulfanyl)-acetamide (PubChem CID 651272) has the molecular formula C19H20N4O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[[5-(phenoxymethyl)-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | 2-(4-Phenethyl-5-phenoxymethyl-4H-[1,2,4]triazol-3-ylsulfanyl)-acetamide |
|---|---|
| PubChem CID | 651272 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[[5-(phenoxymethyl)-4-(2-phenylethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C1=CC=C(C=C1)CCN2C(=NN=C2SCC(=O)N)COC3=CC=CC=C3 |
| InChI | InChI=1S/C19H20N4O2S/c20-17(24)14-26-19-22-21-18(13-25-16-9-5-2-6-10-16)23(19)12-11-15-7-3-1-4-8-15/h1-10H,11-14H2,(H2,20,24) |
| InChIKey | YCQHXTQHTUFESI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | 428 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |