C13H23NS2 — CID 65127910
N-ethyl-1-ethylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-amine (PubChem CID 65127910) has the molecular formula C13H23NS2 and a molecular weight of 257.47 g/mol. Its IUPAC name is N-ethyl-1-ethylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-amine.
| Compound Name | N-ethyl-1-ethylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 65127910 |
| Molecular Formula | C13H23NS2 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-ethyl-1-ethylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-amine |
| SMILES | CCNC(CSCC)Cc1ccc(CC)s1 |
| InChI | InChI=1S/C13H23NS2/c1-4-12-7-8-13(16-12)9-11(14-5-2)10-15-6-3/h7-8,11,14H,4-6,9-10H2,1-3H3 |
| InChIKey | HNEXEJPTDBZFBJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |