C10H18O2S — CID 65131298
3-tert-butyl-1-methylsulfanylcyclobutane-1-carboxylic acid (PubChem CID 65131298) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is 3-tert-butyl-1-methylsulfanylcyclobutane-1-carboxylic acid.
| Compound Name | 3-tert-butyl-1-methylsulfanylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 65131298 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-tert-butyl-1-methylsulfanylcyclobutane-1-carboxylic acid |
| SMILES | CSC1(C(=O)O)CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C10H18O2S/c1-9(2,3)7-5-10(6-7,13-4)8(11)12/h7H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | LMWFYLZMUAZBHJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |