C14H28OS — CID 65136531
2-butan-2-ylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol (PubChem CID 65136531) has the molecular formula C14H28OS and a molecular weight of 244.44 g/mol. Its IUPAC name is 2-butan-2-ylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol.
| Compound Name | 2-butan-2-ylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65136531 |
| Molecular Formula | C14H28OS |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-butan-2-ylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol |
| SMILES | CCC(C)SCC(O)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H28OS/c1-5-12(4)16-9-14(15)13-7-6-10(2)11(3)8-13/h10-15H,5-9H2,1-4H3 |
| InChIKey | OXMQXUCANHEBDD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |