C16H22OS — CID 65138899
1-cyclopentylsulfanyl-3-(3,5-dimethylphenyl)propan-2-one (PubChem CID 65138899) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is 1-cyclopentylsulfanyl-3-(3,5-dimethylphenyl)propan-2-one.
| Compound Name | 1-cyclopentylsulfanyl-3-(3,5-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 65138899 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-cyclopentylsulfanyl-3-(3,5-dimethylphenyl)propan-2-one |
| SMILES | Cc1cc(C)cc(CC(=O)CSC2CCCC2)c1 |
| InChI | InChI=1S/C16H22OS/c1-12-7-13(2)9-14(8-12)10-15(17)11-18-16-5-3-4-6-16/h7-9,16H,3-6,10-11H2,1-2H3 |
| InChIKey | JWCIOVTURXWCEY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |