C16H30OS — CID 65139493
2-cyclohexylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol (PubChem CID 65139493) has the molecular formula C16H30OS and a molecular weight of 270.48 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol.
| Compound Name | 2-cyclohexylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65139493 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-(3,4-dimethylcyclohexyl)ethanol |
| SMILES | CC1CCC(C(O)CSC2CCCCC2)CC1C |
| InChI | InChI=1S/C16H30OS/c1-12-8-9-14(10-13(12)2)16(17)11-18-15-6-4-3-5-7-15/h12-17H,3-11H2,1-2H3 |
| InChIKey | PFZYPAXPCFDSGS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |