About 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide
2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide (PubChem CID 65144617) has the molecular formula C12H24N2S
and a molecular weight of 228.40 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide.
Molecular Properties
| Compound Name | 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide |
| PubChem CID | 65144617 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide |
| SMILES | CC(C)C/N=C(\N)CSC1CCCCC1 |
| InChI | InChI=1S/C12H24N2S/c1-10(2)8-14-12(13)9-15-11-6-4-3-5-7-11/h10-11H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | RAEZRBBOVJKBEB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide?
The IUPAC name of 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide (CID 65144617) is 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide.
What is the SMILES notation for 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide?
The canonical SMILES for 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide is CC(C)C/N=C(\N)CSC1CCCCC1.
What is the InChIKey of 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide?
The InChIKey is RAEZRBBOVJKBEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2S/c1-10(2)8-14-12(13)9-15-11-6-4-3-5-7-11/h10-11H,3-9H2,1-2H3,(H2,13,14).
What are the key properties of 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide?
2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide has a molecular weight of 228.40 g/mol, XLogP of 3.07, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylsulfanyl-N'-(2-methylpropyl)ethanimidamide is sourced from PubChem (CID 65144617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).