About 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide
3-cyclopentylsulfanyl-N'-hydroxypropanimidamide (PubChem CID 76982856) has the molecular formula C8H16N2OS
and a molecular weight of 188.30 g/mol. Its IUPAC name is 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide |
| PubChem CID | 76982856 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide |
| SMILES | NC(CCSC1CCCC1)=NO |
| InChI | InChI=1S/C8H16N2OS/c9-8(10-11)5-6-12-7-3-1-2-4-7/h7,11H,1-6H2,(H2,9,10) |
| InChIKey | DJVMOZCKXGGKBU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide?
The IUPAC name of 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide (CID 76982856) is 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide?
The canonical SMILES for 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide is NC(CCSC1CCCC1)=NO.
What is the InChIKey of 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide?
The InChIKey is DJVMOZCKXGGKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2OS/c9-8(10-11)5-6-12-7-3-1-2-4-7/h7,11H,1-6H2,(H2,9,10).
What are the key properties of 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide?
3-cyclopentylsulfanyl-N'-hydroxypropanimidamide has a molecular weight of 188.30 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylsulfanyl-N'-hydroxypropanimidamide is sourced from PubChem (CID 76982856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).