C18H30OS — CID 65147632
1-[(5-ethylthiophen-2-yl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol (PubChem CID 65147632) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol.
| Compound Name | 1-[(5-ethylthiophen-2-yl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 65147632 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)methyl]-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
| SMILES | CCc1ccc(CC2(O)CCC(C(C)(C)CC)CC2)s1 |
| InChI | InChI=1S/C18H30OS/c1-5-15-7-8-16(20-15)13-18(19)11-9-14(10-12-18)17(3,4)6-2/h7-8,14,19H,5-6,9-13H2,1-4H3 |
| InChIKey | SGJJFXXSQVRCTR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |