C17H17BrFNO — CID 65149599
2-(2-bromo-4-fluorophenyl)-1-(1-methyl-2,3-dihydroindol-5-yl)ethanol (PubChem CID 65149599) has the molecular formula C17H17BrFNO and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(1-methyl-2,3-dihydroindol-5-yl)ethanol.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(1-methyl-2,3-dihydroindol-5-yl)ethanol |
|---|---|
| PubChem CID | 65149599 |
| Molecular Formula | C17H17BrFNO |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(1-methyl-2,3-dihydroindol-5-yl)ethanol |
| SMILES | CN1CCc2cc(C(O)Cc3ccc(F)cc3Br)ccc21 |
| InChI | InChI=1S/C17H17BrFNO/c1-20-7-6-12-8-13(3-5-16(12)20)17(21)9-11-2-4-14(19)10-15(11)18/h2-5,8,10,17,21H,6-7,9H2,1H3 |
| InChIKey | KEBNRICAJCBWSE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|