C17H18F2N2O3S — CID 90582385
2,4-difluoro-N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]benzenesulfonamide (PubChem CID 90582385) has the molecular formula C17H18F2N2O3S and a molecular weight of 368.41 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90582385 |
| Molecular Formula | C17H18F2N2O3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2,4-difluoro-N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CN1CCc2cc(C(O)CNS(=O)(=O)c3ccc(F)cc3F)ccc21 |
| InChI | InChI=1S/C17H18F2N2O3S/c1-21-7-6-11-8-12(2-4-15(11)21)16(22)10-20-25(23,24)17-5-3-13(18)9-14(17)19/h2-5,8-9,16,20,22H,6-7,10H2,1H3 |
| InChIKey | UUDKQJWOVMQPBS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|