C20H33BrN2O — CID 6514962
(E)-5-[2-(diethylamino)ethyl-methylamino]-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide (PubChem CID 6514962) has the molecular formula C20H33BrN2O and a molecular weight of 397.40 g/mol. Its IUPAC name is (E)-5-[2-(diethylamino)ethyl-methylamino]-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide.
| Compound Name | (E)-5-[2-(diethylamino)ethyl-methylamino]-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide |
|---|---|
| PubChem CID | 6514962 |
| Molecular Formula | C20H33BrN2O |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (E)-5-[2-(diethylamino)ethyl-methylamino]-4,4-dimethyl-1-phenylpent-1-en-3-one;hydrobromide |
| SMILES | Br.CCN(CC)CCN(C)CC(C)(C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H32N2O.BrH/c1-6-22(7-2)16-15-21(5)17-20(3,4)19(23)14-13-18-11-9-8-10-12-18;/h8-14H,6-7,15-17H2,1-5H3;1H/b14-13+; |
| InChIKey | NPIWDNQSNBNJKI-IERUDJENSA-N |
| XLogP | 4.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|