C15H18O4S — CID 65151106
2-thiophen-3-yl-1-(2,4,6-trimethoxyphenyl)ethanol (PubChem CID 65151106) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-thiophen-3-yl-1-(2,4,6-trimethoxyphenyl)ethanol.
| Compound Name | 2-thiophen-3-yl-1-(2,4,6-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 65151106 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-thiophen-3-yl-1-(2,4,6-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)c(C(O)Cc2ccsc2)c(OC)c1 |
| InChI | InChI=1S/C15H18O4S/c1-17-11-7-13(18-2)15(14(8-11)19-3)12(16)6-10-4-5-20-9-10/h4-5,7-9,12,16H,6H2,1-3H3 |
| InChIKey | BHCAETAFODJITL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |