C15H18N2O2 — CID 65151872
N-(3-amino-2-methylphenyl)-2,4,5-trimethylfuran-3-carboxamide (PubChem CID 65151872) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(3-amino-2-methylphenyl)-2,4,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(3-amino-2-methylphenyl)-2,4,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 65151872 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-(3-amino-2-methylphenyl)-2,4,5-trimethylfuran-3-carboxamide |
| SMILES | Cc1oc(C)c(C(=O)Nc2cccc(N)c2C)c1C |
| InChI | InChI=1S/C15H18N2O2/c1-8-10(3)19-11(4)14(8)15(18)17-13-7-5-6-12(16)9(13)2/h5-7H,16H2,1-4H3,(H,17,18) |
| InChIKey | HIKSOPPRSWCHBG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|