C14H15BrN2O2 — CID 65151528
N-(4-amino-2-bromophenyl)-2,4,5-trimethylfuran-3-carboxamide (PubChem CID 65151528) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is N-(4-amino-2-bromophenyl)-2,4,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(4-amino-2-bromophenyl)-2,4,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 65151528 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-(4-amino-2-bromophenyl)-2,4,5-trimethylfuran-3-carboxamide |
| SMILES | Cc1oc(C)c(C(=O)Nc2ccc(N)cc2Br)c1C |
| InChI | InChI=1S/C14H15BrN2O2/c1-7-8(2)19-9(3)13(7)14(18)17-12-5-4-10(16)6-11(12)15/h4-6H,16H2,1-3H3,(H,17,18) |
| InChIKey | ZRUUJLLTEHZWTL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|