C17H21BrO — CID 65152403
3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4,5-trimethylfuran (PubChem CID 65152403) has the molecular formula C17H21BrO and a molecular weight of 321.26 g/mol. Its IUPAC name is 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4,5-trimethylfuran.
| Compound Name | 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4,5-trimethylfuran |
|---|---|
| PubChem CID | 65152403 |
| Molecular Formula | C17H21BrO |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-[1-bromo-2-(2,5-dimethylphenyl)ethyl]-2,4,5-trimethylfuran |
| SMILES | Cc1ccc(C)c(CC(Br)c2c(C)oc(C)c2C)c1 |
| InChI | InChI=1S/C17H21BrO/c1-10-6-7-11(2)15(8-10)9-16(18)17-12(3)13(4)19-14(17)5/h6-8,16H,9H2,1-5H3 |
| InChIKey | OQNCNCUTVWLUMC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|